C22H25FN6O2 — CID 155586926
5-[4-[(3-ethyl-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 155586926) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 5-[4-[(3-ethyl-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[(3-ethyl-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155586926 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5-[4-[(3-ethyl-2-oxo-1H-1,6-naphthyridin-7-yl)methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CCc1cc2cnc(CN3CCN(c4ccc(C(=O)NC)nc4F)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H25FN6O2/c1-3-14-10-15-12-25-16(11-18(15)27-21(14)30)13-28-6-8-29(9-7-28)19-5-4-17(22(31)24-2)26-20(19)23/h4-5,10-12H,3,6-9,13H2,1-2H3,(H,24,31)(H,27,30) |
| InChIKey | XKSQRLIEJSXRFK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|