C31H42FN5O2 — CID 155587360
1-[2-[(2E,4Z)-6-[[[6-[(Z,2E)-2-ethylidene-6-fluoro-5-methylidenehept-3-enoxy]pyridazin-3-yl]amino]methyl]hepta-2,4,6-trien-3-yl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone (PubChem CID 155587360) has the molecular formula C31H42FN5O2 and a molecular weight of 535.71 g/mol. Its IUPAC name is 1-[2-[(2E,4Z)-6-[[[6-[(Z,2E)-2-ethylidene-6-fluoro-5-methylidenehept-3-enoxy]pyridazin-3-yl]amino]methyl]hepta-2,4,6-trien-3-yl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone.
| Compound Name | 1-[2-[(2E,4Z)-6-[[[6-[(Z,2E)-2-ethylidene-6-fluoro-5-methylidenehept-3-enoxy]pyridazin-3-yl]amino]methyl]hepta-2,4,6-trien-3-yl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
|---|---|
| PubChem CID | 155587360 |
| Molecular Formula | C31H42FN5O2 |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 1-[2-[(2E,4Z)-6-[[[6-[(Z,2E)-2-ethylidene-6-fluoro-5-methylidenehept-3-enoxy]pyridazin-3-yl]amino]methyl]hepta-2,4,6-trien-3-yl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
| SMILES | C=C(/C=C\C(=C/C)N1CC2(CCN(C(C)=O)CC2)C1)CNc1ccc(OCC(/C=C\C(=C)C(C)F)=C/C)nn1 |
| InChI | InChI=1S/C31H42FN5O2/c1-7-27(11-10-24(4)25(5)32)20-39-30-14-13-29(34-35-30)33-19-23(3)9-12-28(8-2)37-21-31(22-37)15-17-36(18-16-31)26(6)38/h7-14,25H,3-4,15-22H2,1-2,5-6H3,(H,33,34)/b11-10-,12-9-,27-7+,28-8+ |
| InChIKey | DXLGPROQYZWAIH-MNTGDTQZSA-N |
| XLogP | 5.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|