C25H26N8O3S — CID 155587473
6-[7-(3-methylsulfonylpropoxy)imidazo[1,2-a]pyridin-3-yl]-N-[[4-(2-methyltriazol-4-yl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 155587473) has the molecular formula C25H26N8O3S and a molecular weight of 518.60 g/mol. Its IUPAC name is 6-[7-(3-methylsulfonylpropoxy)imidazo[1,2-a]pyridin-3-yl]-N-[[4-(2-methyltriazol-4-yl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-[7-(3-methylsulfonylpropoxy)imidazo[1,2-a]pyridin-3-yl]-N-[[4-(2-methyltriazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155587473 |
| Molecular Formula | C25H26N8O3S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 6-[7-(3-methylsulfonylpropoxy)imidazo[1,2-a]pyridin-3-yl]-N-[[4-(2-methyltriazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | Cn1ncc(-c2ccc(CNc3cc(-c4cnc5cc(OCCCS(C)(=O)=O)ccn45)ncn3)cc2)n1 |
| InChI | InChI=1S/C25H26N8O3S/c1-32-30-15-22(31-32)19-6-4-18(5-7-19)14-26-24-13-21(28-17-29-24)23-16-27-25-12-20(8-9-33(23)25)36-10-3-11-37(2,34)35/h4-9,12-13,15-17H,3,10-11,14H2,1-2H3,(H,26,28,29) |
| InChIKey | CFACTWYQKHCAPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|