C26H33N9O — CID 155587482
6-[7-[3-(dimethylamino)propoxy]imidazo[1,2-a]pyridin-3-yl]pyrimidin-4-amine;N-[(Z)-[2-imino-1-(4-methylphenyl)ethylidene]amino]methanamine (PubChem CID 155587482) has the molecular formula C26H33N9O and a molecular weight of 487.61 g/mol. Its IUPAC name is 6-[7-[3-(dimethylamino)propoxy]imidazo[1,2-a]pyridin-3-yl]pyrimidin-4-amine;N-[(Z)-[2-imino-1-(4-methylphenyl)ethylidene]amino]methanamine.
| Compound Name | 6-[7-[3-(dimethylamino)propoxy]imidazo[1,2-a]pyridin-3-yl]pyrimidin-4-amine;N-[(Z)-[2-imino-1-(4-methylphenyl)ethylidene]amino]methanamine |
|---|---|
| PubChem CID | 155587482 |
| Molecular Formula | C26H33N9O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 6-[7-[3-(dimethylamino)propoxy]imidazo[1,2-a]pyridin-3-yl]pyrimidin-4-amine;N-[(Z)-[2-imino-1-(4-methylphenyl)ethylidene]amino]methanamine |
| SMILES | CN(C)CCCOc1ccn2c(-c3cc(N)ncn3)cnc2c1.[H]/N=C/C(=N\NC)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20N6O.C10H13N3/c1-21(2)5-3-7-23-12-4-6-22-14(10-18-16(22)8-12)13-9-15(17)20-11-19-13;1-8-3-5-9(6-4-8)10(7-11)13-12-2/h4,6,8-11H,3,5,7H2,1-2H3,(H2,17,19,20);3-7,11-12H,1-2H3/b;11-7+,13-10+ |
| InChIKey | VWHQUEQUOLHLHI-WEGSQBDZSA-N |
| XLogP | 3.27 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|