C15H11ClN2O2S — CID 155587916
2-(2-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-6-nitroquinoline (PubChem CID 155587916) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 2-(2-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-6-nitroquinoline.
| Compound Name | 2-(2-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-6-nitroquinoline |
|---|---|
| PubChem CID | 155587916 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-(2-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-6-nitroquinoline |
| SMILES | O=[N+]([O-])c1ccc2nc(SC3=C(Cl)CCC=C3)ccc2c1 |
| InChI | InChI=1S/C15H11ClN2O2S/c16-12-3-1-2-4-14(12)21-15-8-5-10-9-11(18(19)20)6-7-13(10)17-15/h2,4-9H,1,3H2 |
| InChIKey | UJIXTAONMSHORF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|