C25H37NO5 — CID 155588488
tert-butyl 2-[2-(5,7-dihydroxy-1,2,3,4-tetrahydroquinolin-8-yl)-4-methylcyclohex-3-en-1-yl]prop-2-enoate;ethanol (PubChem CID 155588488) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl 2-[2-(5,7-dihydroxy-1,2,3,4-tetrahydroquinolin-8-yl)-4-methylcyclohex-3-en-1-yl]prop-2-enoate;ethanol.
| Compound Name | tert-butyl 2-[2-(5,7-dihydroxy-1,2,3,4-tetrahydroquinolin-8-yl)-4-methylcyclohex-3-en-1-yl]prop-2-enoate;ethanol |
|---|---|
| PubChem CID | 155588488 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl 2-[2-(5,7-dihydroxy-1,2,3,4-tetrahydroquinolin-8-yl)-4-methylcyclohex-3-en-1-yl]prop-2-enoate;ethanol |
| SMILES | C=C(C(=O)OC(C)(C)C)C1CCC(C)=CC1c1c(O)cc(O)c2c1NCCC2.CCO |
| InChI | InChI=1S/C23H31NO4.C2H6O/c1-13-8-9-15(14(2)22(27)28-23(3,4)5)17(11-13)20-19(26)12-18(25)16-7-6-10-24-21(16)20;1-2-3/h11-12,15,17,24-26H,2,6-10H2,1,3-5H3;3H,2H2,1H3 |
| InChIKey | CTQMOWAFNVJXHG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|