C19H16F4O4 — CID 155588671
2-[2-fluoro-5-phenylmethoxy-4-[2-(trifluoromethyl)oxetan-2-yl]phenyl]acetic acid (PubChem CID 155588671) has the molecular formula C19H16F4O4 and a molecular weight of 384.33 g/mol. Its IUPAC name is 2-[2-fluoro-5-phenylmethoxy-4-[2-(trifluoromethyl)oxetan-2-yl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-phenylmethoxy-4-[2-(trifluoromethyl)oxetan-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 155588671 |
| Molecular Formula | C19H16F4O4 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[2-fluoro-5-phenylmethoxy-4-[2-(trifluoromethyl)oxetan-2-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(OCc2ccccc2)c(C2(C(F)(F)F)CCO2)cc1F |
| InChI | InChI=1S/C19H16F4O4/c20-15-10-14(18(6-7-27-18)19(21,22)23)16(8-13(15)9-17(24)25)26-11-12-4-2-1-3-5-12/h1-5,8,10H,6-7,9,11H2,(H,24,25) |
| InChIKey | YRIJYPDGYQCVTF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |