About N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide
N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide (PubChem CID 155589095) has the molecular formula C23H19BrN2O4S2
and a molecular weight of 531.45 g/mol. Its IUPAC name is N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide |
| PubChem CID | 155589095 |
| Molecular Formula | C23H19BrN2O4S2 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1c(-c2ccccc2)c(-c2ccccc2)nc2ccc(Br)cc12)S(C)(=O)=O |
| InChI | InChI=1S/C23H19BrN2O4S2/c1-31(27,28)26(32(2,29)30)23-19-15-18(24)13-14-20(19)25-22(17-11-7-4-8-12-17)21(23)16-9-5-3-6-10-16/h3-15H,1-2H3 |
| InChIKey | XLJACAWFIZCWJW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide?
The IUPAC name of N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide (CID 155589095) is N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide.
What is the SMILES notation for N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide?
The canonical SMILES for N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide is CS(=O)(=O)N(c1c(-c2ccccc2)c(-c2ccccc2)nc2ccc(Br)cc12)S(C)(=O)=O.
What is the InChIKey of N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide?
The InChIKey is XLJACAWFIZCWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19BrN2O4S2/c1-31(27,28)26(32(2,29)30)23-19-15-18(24)13-14-20(19)25-22(17-11-7-4-8-12-17)21(23)16-9-5-3-6-10-16/h3-15H,1-2H3.
What are the key properties of N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide?
N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide has a molecular weight of 531.45 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2,3-diphenylquinolin-4-yl)-N-methylsulfonylmethanesulfonamide is sourced from PubChem (CID 155589095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).