C25H24N4O2 — CID 155589157
1-(6,7-diphenyl-1,5-naphthyridin-2-yl)-3-(2-hydroxybutyl)urea (PubChem CID 155589157) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(6,7-diphenyl-1,5-naphthyridin-2-yl)-3-(2-hydroxybutyl)urea.
| Compound Name | 1-(6,7-diphenyl-1,5-naphthyridin-2-yl)-3-(2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 155589157 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-(6,7-diphenyl-1,5-naphthyridin-2-yl)-3-(2-hydroxybutyl)urea |
| SMILES | CCC(O)CNC(=O)Nc1ccc2nc(-c3ccccc3)c(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-19(30)16-26-25(31)29-23-14-13-21-22(27-23)15-20(17-9-5-3-6-10-17)24(28-21)18-11-7-4-8-12-18/h3-15,19,30H,2,16H2,1H3,(H2,26,27,29,31) |
| InChIKey | MHKKAAIVJUIBII-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |