C23H26N8O2S — CID 155589599
N-methyl-N-[(2S)-1-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethylamino]-1-oxopropan-2-yl]but-2-ynamide (PubChem CID 155589599) has the molecular formula C23H26N8O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is N-methyl-N-[(2S)-1-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethylamino]-1-oxopropan-2-yl]but-2-ynamide.
| Compound Name | N-methyl-N-[(2S)-1-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethylamino]-1-oxopropan-2-yl]but-2-ynamide |
|---|---|
| PubChem CID | 155589599 |
| Molecular Formula | C23H26N8O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-methyl-N-[(2S)-1-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethylamino]-1-oxopropan-2-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N(C)[C@@H](C)C(=O)NCCNc1cc(Nc2ncc(-c3ccncc3)s2)nc(C)n1 |
| InChI | InChI=1S/C23H26N8O2S/c1-5-6-21(32)31(4)15(2)22(33)26-12-11-25-19-13-20(29-16(3)28-19)30-23-27-14-18(34-23)17-7-9-24-10-8-17/h7-10,13-15H,11-12H2,1-4H3,(H,26,33)(H2,25,27,28,29,30)/t15-/m0/s1 |
| InChIKey | FGMVYYWLHKQSQJ-HNNXBMFYSA-N |
| XLogP | 2.45 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|