C23H28N8O2S — CID 155589610
N-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]formamide;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 155589610) has the molecular formula C23H28N8O2S and a molecular weight of 480.60 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]formamide;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | N-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]formamide;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 155589610 |
| Molecular Formula | C23H28N8O2S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[2-[[2-methyl-6-[(5-pyridin-4-yl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]formamide;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.Cc1nc(NCCNC=O)cc(Nc2ncc(-c3ccncc3)s2)n1 |
| InChI | InChI=1S/C16H17N7OS.C7H11NO/c1-11-21-14(19-7-6-18-10-24)8-15(22-11)23-16-20-9-13(25-16)12-2-4-17-5-3-12;1-2-7(9)8-5-3-4-6-8/h2-5,8-10H,6-7H2,1H3,(H,18,24)(H2,19,20,21,22,23);2H,1,3-6H2 |
| InChIKey | AFHQAKITNZUEGU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|