C24H26N6O4S — CID 155589624
N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-4-prop-2-enoylmorpholine-3-carboxamide (PubChem CID 155589624) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-4-prop-2-enoylmorpholine-3-carboxamide.
| Compound Name | N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-4-prop-2-enoylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 155589624 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-4-prop-2-enoylmorpholine-3-carboxamide |
| SMILES | C=CC(=O)N1CCOCC1C(=O)NCCOc1cc(Nc2ncc(-c3ccccc3)s2)nc(C)n1 |
| InChI | InChI=1S/C24H26N6O4S/c1-3-22(31)30-10-12-33-15-18(30)23(32)25-9-11-34-21-13-20(27-16(2)28-21)29-24-26-14-19(35-24)17-7-5-4-6-8-17/h3-8,13-14,18H,1,9-12,15H2,2H3,(H,25,32)(H,26,27,28,29) |
| InChIKey | LWBPUNQHXVYEQW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|