C18H24N6S — CID 155589636
4-N-(2-aminoethyl)-6-N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-4-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 155589636) has the molecular formula C18H24N6S and a molecular weight of 356.50 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)-6-N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-4-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-aminoethyl)-6-N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-4-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 155589636 |
| Molecular Formula | C18H24N6S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-N-(2-aminoethyl)-6-N-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]-4-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | C=C/C=C(\C=C/C)c1cnc(Nc2cc(N(C)CCN)nc(C)n2)s1 |
| InChI | InChI=1S/C18H24N6S/c1-5-7-14(8-6-2)15-12-20-18(25-15)23-16-11-17(22-13(3)21-16)24(4)10-9-19/h5-8,11-12H,1,9-10,19H2,2-4H3,(H,20,21,22,23)/b8-6-,14-7+ |
| InChIKey | IWIDQORVEGFKMJ-VGVFFUEXSA-N |
| XLogP | 3.53 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|