C21H29N7OS — CID 155589653
N-[2-[[6-[[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-(methylamino)propanamide (PubChem CID 155589653) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is N-[2-[[6-[[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-(methylamino)propanamide.
| Compound Name | N-[2-[[6-[[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 155589653 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[2-[[6-[[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3-thiazol-2-yl]amino]-2-methylpyrimidin-4-yl]amino]ethyl]-2-(methylamino)propanamide |
| SMILES | C=C/C=C(\C=C/C)c1cnc(Nc2cc(NCCNC(=O)C(C)NC)nc(C)n2)s1 |
| InChI | InChI=1S/C21H29N7OS/c1-6-8-16(9-7-2)17-13-25-21(30-17)28-19-12-18(26-15(4)27-19)23-10-11-24-20(29)14(3)22-5/h6-9,12-14,22H,1,10-11H2,2-5H3,(H,24,29)(H2,23,25,26,27,28)/b9-7-,16-8+ |
| InChIKey | QTAAIIIHTTXZTC-KQGIKXCNSA-N |
| XLogP | 3.27 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|