C21H28N6O3S — CID 155589670
N-[2-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethylamino]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 155589670) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[2-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethylamino]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethylamino]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 155589670 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[2-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethylamino]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)NCCOc1cc(Nc2ncc(C3CCC3)s2)nc(CC)n1 |
| InChI | InChI=1S/C21H28N6O3S/c1-4-16-24-17(26-21-23-12-15(31-21)14-7-6-8-14)11-19(25-16)30-10-9-22-18(28)13-27(3)20(29)5-2/h5,11-12,14H,2,4,6-10,13H2,1,3H3,(H,22,28)(H,23,24,25,26) |
| InChIKey | OOGLTLZPVYIAAN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|