C20H29N5O3S — CID 155589677
tert-butyl N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]carbamate (PubChem CID 155589677) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is tert-butyl N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 155589677 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[2-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxyethyl]carbamate |
| SMILES | CCc1nc(Nc2ncc(C3CCC3)s2)cc(OCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C20H29N5O3S/c1-5-15-23-16(25-18-22-12-14(29-18)13-7-6-8-13)11-17(24-15)27-10-9-21-19(26)28-20(2,3)4/h11-13H,5-10H2,1-4H3,(H,21,26)(H,22,23,24,25) |
| InChIKey | QIHBUASAXLWHCK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|