C20H25N7OS — CID 155589680
(2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]propanamide (PubChem CID 155589680) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]propanamide.
| Compound Name | (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 155589680 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (2S)-2-(methylamino)-N-[2-[[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]amino]ethyl]propanamide |
| SMILES | CN[C@@H](C)C(=O)NCCNc1cc(Nc2ncc(-c3ccccc3)s2)nc(C)n1 |
| InChI | InChI=1S/C20H25N7OS/c1-13(21-3)19(28)23-10-9-22-17-11-18(26-14(2)25-17)27-20-24-12-16(29-20)15-7-5-4-6-8-15/h4-8,11-13,21H,9-10H2,1-3H3,(H,23,28)(H2,22,24,25,26,27)/t13-/m0/s1 |
| InChIKey | BDAWPWNZTYZNKZ-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|