C21H28N6O2S — CID 155589716
N-[6-(2-aminoethoxy)-2-methylpyrimidin-4-yl]-5-phenyl-1,3-thiazol-2-amine;3-(dimethylamino)prop-1-en-2-ol (PubChem CID 155589716) has the molecular formula C21H28N6O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[6-(2-aminoethoxy)-2-methylpyrimidin-4-yl]-5-phenyl-1,3-thiazol-2-amine;3-(dimethylamino)prop-1-en-2-ol.
| Compound Name | N-[6-(2-aminoethoxy)-2-methylpyrimidin-4-yl]-5-phenyl-1,3-thiazol-2-amine;3-(dimethylamino)prop-1-en-2-ol |
|---|---|
| PubChem CID | 155589716 |
| Molecular Formula | C21H28N6O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[6-(2-aminoethoxy)-2-methylpyrimidin-4-yl]-5-phenyl-1,3-thiazol-2-amine;3-(dimethylamino)prop-1-en-2-ol |
| SMILES | C=C(O)CN(C)C.Cc1nc(Nc2ncc(-c3ccccc3)s2)cc(OCCN)n1 |
| InChI | InChI=1S/C16H17N5OS.C5H11NO/c1-11-19-14(9-15(20-11)22-8-7-17)21-16-18-10-13(23-16)12-5-3-2-4-6-12;1-5(7)4-6(2)3/h2-6,9-10H,7-8,17H2,1H3,(H,18,19,20,21);7H,1,4H2,2-3H3 |
| InChIKey | PTDCCQUIKLQVID-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|