C21H24N6O3S — CID 155589764
N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]morpholine-3-carboxamide (PubChem CID 155589764) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]morpholine-3-carboxamide.
| Compound Name | N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 155589764 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]morpholine-3-carboxamide |
| SMILES | Cc1nc(Nc2ncc(-c3ccccc3)s2)cc(OCCNC(=O)C2COCCN2)n1 |
| InChI | InChI=1S/C21H24N6O3S/c1-14-25-18(27-21-24-12-17(31-21)15-5-3-2-4-6-15)11-19(26-14)30-10-8-23-20(28)16-13-29-9-7-22-16/h2-6,11-12,16,22H,7-10,13H2,1H3,(H,23,28)(H,24,25,26,27) |
| InChIKey | GEPCIQVBGFQIGS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|