C23H26N6O3S — CID 155589784
(2S)-N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide (PubChem CID 155589784) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is (2S)-N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide.
| Compound Name | (2S)-N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
|---|---|
| PubChem CID | 155589784 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (2S)-N-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethyl]-2-[methyl(prop-2-enoyl)amino]propanamide |
| SMILES | C=CC(=O)N(C)[C@@H](C)C(=O)NCCOc1cc(Nc2ncc(-c3ccccc3)s2)nc(C)n1 |
| InChI | InChI=1S/C23H26N6O3S/c1-5-21(30)29(4)15(2)22(31)24-11-12-32-20-13-19(26-16(3)27-20)28-23-25-14-18(33-23)17-9-7-6-8-10-17/h5-10,13-15H,1,11-12H2,2-4H3,(H,24,31)(H,25,26,27,28)/t15-/m0/s1 |
| InChIKey | UBTIXBBKZFJMFU-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|