About 5-methylindazol-2-ide;propane;rhenium
5-methylindazol-2-ide;propane;rhenium (PubChem CID 155590157) has the molecular formula C11H15N2Re-
and a molecular weight of 361.46 g/mol. Its IUPAC name is 5-methylindazol-2-ide;propane;rhenium.
Molecular Properties
| Compound Name | 5-methylindazol-2-ide;propane;rhenium |
| PubChem CID | 155590157 |
| Molecular Formula | C11H15N2Re- |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-methylindazol-2-ide;propane;rhenium |
| SMILES | CCC.Cc1ccc2n[n-]cc2c1.[Re] |
| InChI | InChI=1S/C8H7N2.C3H8.Re/c1-6-2-3-8-7(4-6)5-9-10-8;1-3-2;/h2-5H,1H3;3H2,1-2H3;/q-1;; |
| InChIKey | UNLXLSUBAYNKTI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylindazol-2-ide;propane;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylindazol-2-ide;propane;rhenium?
The IUPAC name of 5-methylindazol-2-ide;propane;rhenium (CID 155590157) is 5-methylindazol-2-ide;propane;rhenium.
What is the SMILES notation for 5-methylindazol-2-ide;propane;rhenium?
The canonical SMILES for 5-methylindazol-2-ide;propane;rhenium is CCC.Cc1ccc2n[n-]cc2c1.[Re].
What is the InChIKey of 5-methylindazol-2-ide;propane;rhenium?
The InChIKey is UNLXLSUBAYNKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.C3H8.Re/c1-6-2-3-8-7(4-6)5-9-10-8;1-3-2;/h2-5H,1H3;3H2,1-2H3;/q-1;;.
What are the key properties of 5-methylindazol-2-ide;propane;rhenium?
5-methylindazol-2-ide;propane;rhenium has a molecular weight of 361.46 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylindazol-2-ide;propane;rhenium is sourced from PubChem (CID 155590157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).