About 2,6-dichloro-N,N-diethylpurine-9-sulfonamide
2,6-dichloro-N,N-diethylpurine-9-sulfonamide (PubChem CID 155590172) has the molecular formula C9H11Cl2N5O2S
and a molecular weight of 324.19 g/mol. Its IUPAC name is 2,6-dichloro-N,N-diethylpurine-9-sulfonamide.
Molecular Properties
| Compound Name | 2,6-dichloro-N,N-diethylpurine-9-sulfonamide |
| PubChem CID | 155590172 |
| Molecular Formula | C9H11Cl2N5O2S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2,6-dichloro-N,N-diethylpurine-9-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)n1cnc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C9H11Cl2N5O2S/c1-3-15(4-2)19(17,18)16-5-12-6-7(10)13-9(11)14-8(6)16/h5H,3-4H2,1-2H3 |
| InChIKey | KALIGOCEHBEGSB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-dichloro-N,N-diethylpurine-9-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-N,N-diethylpurine-9-sulfonamide?
The IUPAC name of 2,6-dichloro-N,N-diethylpurine-9-sulfonamide (CID 155590172) is 2,6-dichloro-N,N-diethylpurine-9-sulfonamide.
What is the SMILES notation for 2,6-dichloro-N,N-diethylpurine-9-sulfonamide?
The canonical SMILES for 2,6-dichloro-N,N-diethylpurine-9-sulfonamide is CCN(CC)S(=O)(=O)n1cnc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2,6-dichloro-N,N-diethylpurine-9-sulfonamide?
The InChIKey is KALIGOCEHBEGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N5O2S/c1-3-15(4-2)19(17,18)16-5-12-6-7(10)13-9(11)14-8(6)16/h5H,3-4H2,1-2H3.
What are the key properties of 2,6-dichloro-N,N-diethylpurine-9-sulfonamide?
2,6-dichloro-N,N-diethylpurine-9-sulfonamide has a molecular weight of 324.19 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-N,N-diethylpurine-9-sulfonamide is sourced from PubChem (CID 155590172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).