C19H35N5O4 — CID 155591036
tert-butyl N-[5-amino-5-[3-[(Z)-4-amino-2-ethenylbut-2-enyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol (PubChem CID 155591036) has the molecular formula C19H35N5O4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[5-amino-5-[3-[(Z)-4-amino-2-ethenylbut-2-enyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol.
| Compound Name | tert-butyl N-[5-amino-5-[3-[(Z)-4-amino-2-ethenylbut-2-enyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol |
|---|---|
| PubChem CID | 155591036 |
| Molecular Formula | C19H35N5O4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | tert-butyl N-[5-amino-5-[3-[(Z)-4-amino-2-ethenylbut-2-enyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol |
| SMILES | C=C/C(=C\CN)Cc1noc(C(N)CCCCNC(=O)OC(C)(C)C)n1.CO |
| InChI | InChI=1S/C18H31N5O3.CH4O/c1-5-13(9-10-19)12-15-22-16(26-23-15)14(20)8-6-7-11-21-17(24)25-18(2,3)4;1-2/h5,9,14H,1,6-8,10-12,19-20H2,2-4H3,(H,21,24);2H,1H3/b13-9+; |
| InChIKey | BPUANUMITZTHFO-KJEVSKRMSA-N |
| XLogP | 1.99 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|