About 7-bromo-2-methylindazole;ethane
7-bromo-2-methylindazole;ethane (PubChem CID 155591280) has the molecular formula C10H13BrN2
and a molecular weight of 241.13 g/mol. Its IUPAC name is 7-bromo-2-methylindazole;ethane.
Molecular Properties
| Compound Name | 7-bromo-2-methylindazole;ethane |
| PubChem CID | 155591280 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 7-bromo-2-methylindazole;ethane |
| SMILES | CC.Cn1cc2cccc(Br)c2n1 |
| InChI | InChI=1S/C8H7BrN2.C2H6/c1-11-5-6-3-2-4-7(9)8(6)10-11;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | BGBQUIRTCGVNSV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-methylindazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-methylindazole;ethane?
The IUPAC name of 7-bromo-2-methylindazole;ethane (CID 155591280) is 7-bromo-2-methylindazole;ethane.
What is the SMILES notation for 7-bromo-2-methylindazole;ethane?
The canonical SMILES for 7-bromo-2-methylindazole;ethane is CC.Cn1cc2cccc(Br)c2n1.
What is the InChIKey of 7-bromo-2-methylindazole;ethane?
The InChIKey is BGBQUIRTCGVNSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2.C2H6/c1-11-5-6-3-2-4-7(9)8(6)10-11;1-2/h2-5H,1H3;1-2H3.
What are the key properties of 7-bromo-2-methylindazole;ethane?
7-bromo-2-methylindazole;ethane has a molecular weight of 241.13 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-methylindazole;ethane is sourced from PubChem (CID 155591280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).