About [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate
[(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (PubChem CID 155591410) has the molecular formula C21H17ClFN3O4S
and a molecular weight of 461.90 g/mol. Its IUPAC name is [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
Molecular Properties
| Compound Name | [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| PubChem CID | 155591410 |
| Molecular Formula | C21H17ClFN3O4S |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate |
| SMILES | COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O/N=C(\C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17ClFN3O4S/c1-12(13-7-9-14(23)10-8-13)26-30-20(27)19-15(22)5-4-6-16(19)31-21-24-17(28-2)11-18(25-21)29-3/h4-11H,1-3H3/b26-12+ |
| InChIKey | SAPBAZIWUHUILC-RPPGKUMJSA-N |
| XLogP | 5.02 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The IUPAC name of [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate (CID 155591410) is [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate.
What is the SMILES notation for [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The canonical SMILES for [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O/N=C(\C)c2ccc(F)cc2)n1.
What is the InChIKey of [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
The InChIKey is SAPBAZIWUHUILC-RPPGKUMJSA-N. The full InChI is InChI=1S/C21H17ClFN3O4S/c1-12(13-7-9-14(23)10-8-13)26-30-20(27)19-15(22)5-4-6-16(19)31-21-24-17(28-2)11-18(25-21)29-3/h4-11H,1-3H3/b26-12+.
What are the key properties of [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate?
[(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate has a molecular weight of 461.90 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(4-fluorophenyl)ethylideneamino] 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoate is sourced from PubChem (CID 155591410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).