About 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine
6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine (PubChem CID 155591645) has the molecular formula C13H13Cl3N4O
and a molecular weight of 347.63 g/mol. Its IUPAC name is 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine |
| PubChem CID | 155591645 |
| Molecular Formula | C13H13Cl3N4O |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)Nc1ncnc(Oc2c(Cl)cc(N)cc2Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl3N4O/c1-6(2)20-12-10(16)13(19-5-18-12)21-11-8(14)3-7(17)4-9(11)15/h3-6H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | OOZKHEPCPOLVHA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine?
The IUPAC name of 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine (CID 155591645) is 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine.
What is the SMILES notation for 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine?
The canonical SMILES for 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine is CC(C)Nc1ncnc(Oc2c(Cl)cc(N)cc2Cl)c1Cl.
What is the InChIKey of 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine?
The InChIKey is OOZKHEPCPOLVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl3N4O/c1-6(2)20-12-10(16)13(19-5-18-12)21-11-8(14)3-7(17)4-9(11)15/h3-6H,17H2,1-2H3,(H,18,19,20).
What are the key properties of 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine?
6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine has a molecular weight of 347.63 g/mol, XLogP of 4.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-amino-2,6-dichlorophenoxy)-5-chloro-N-propan-2-ylpyrimidin-4-amine is sourced from PubChem (CID 155591645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).