C24H24N2O3 — CID 155591963
4-(2,6-dimethyl-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-pyridin-2-ylcyclohexane-1-carboxamide (PubChem CID 155591963) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-pyridin-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-(2,6-dimethyl-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-pyridin-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155591963 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-(2,6-dimethyl-4-prop-1-ynylphenyl)-N-methyl-3,5-dioxo-N-pyridin-2-ylcyclohexane-1-carboxamide |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C(=O)N(C)c3ccccn3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-5-8-17-11-15(2)22(16(3)12-17)23-19(27)13-18(14-20(23)28)24(29)26(4)21-9-6-7-10-25-21/h6-7,9-12,18,23H,13-14H2,1-4H3 |
| InChIKey | QQHAGEVXASTAGW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|