C24H27F2NO3 — CID 155592014
5-[1-(2,2-difluoroacetyl)piperidin-4-yl]-2-(2,6-dimethyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione (PubChem CID 155592014) has the molecular formula C24H27F2NO3 and a molecular weight of 415.48 g/mol. Its IUPAC name is 5-[1-(2,2-difluoroacetyl)piperidin-4-yl]-2-(2,6-dimethyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-[1-(2,2-difluoroacetyl)piperidin-4-yl]-2-(2,6-dimethyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 155592014 |
| Molecular Formula | C24H27F2NO3 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-[1-(2,2-difluoroacetyl)piperidin-4-yl]-2-(2,6-dimethyl-4-prop-1-ynylphenyl)cyclohexane-1,3-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C3CCN(C(=O)C(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H27F2NO3/c1-4-5-16-10-14(2)21(15(3)11-16)22-19(28)12-18(13-20(22)29)17-6-8-27(9-7-17)24(30)23(25)26/h10-11,17-18,22-23H,6-9,12-13H2,1-3H3 |
| InChIKey | BPWVLUDRJSYAAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|