C23H23ClFNO4 — CID 155592040
4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N,1-trimethyl-3,5-dioxocyclohexane-1-carboxamide (PubChem CID 155592040) has the molecular formula C23H23ClFNO4 and a molecular weight of 431.89 g/mol. Its IUPAC name is 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N,1-trimethyl-3,5-dioxocyclohexane-1-carboxamide.
| Compound Name | 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N,1-trimethyl-3,5-dioxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155592040 |
| Molecular Formula | C23H23ClFNO4 |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N,1-trimethyl-3,5-dioxocyclohexane-1-carboxamide |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(Cl)c1C1C(=O)CC(C)(C(=O)N(C)C)CC1=O |
| InChI | InChI=1S/C23H23ClFNO4/c1-23(22(29)26(2)3)11-17(27)21(18(28)12-23)20-16(24)9-14(10-19(20)30-4)13-5-7-15(25)8-6-13/h5-10,21H,11-12H2,1-4H3 |
| InChIKey | KJGQWGSPYRCADW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|