C24H25ClFNO4 — CID 155592083
4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N-diethyl-3,5-dioxocyclohexane-1-carboxamide (PubChem CID 155592083) has the molecular formula C24H25ClFNO4 and a molecular weight of 445.92 g/mol. Its IUPAC name is 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N-diethyl-3,5-dioxocyclohexane-1-carboxamide.
| Compound Name | 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N-diethyl-3,5-dioxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155592083 |
| Molecular Formula | C24H25ClFNO4 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-N,N-diethyl-3,5-dioxocyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1CC(=O)C(c2c(Cl)cc(-c3ccc(F)cc3)cc2OC)C(=O)C1 |
| InChI | InChI=1S/C24H25ClFNO4/c1-4-27(5-2)24(30)16-11-19(28)23(20(29)12-16)22-18(25)10-15(13-21(22)31-3)14-6-8-17(26)9-7-14/h6-10,13,16,23H,4-5,11-12H2,1-3H3 |
| InChIKey | YVDXZUBDJBSEDF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|