C26H29FN2O3 — CID 155592131
3-[4-(5-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide (PubChem CID 155592131) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-[4-(5-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide.
| Compound Name | 3-[4-(5-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 155592131 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[4-(5-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide |
| SMILES | CNC(=O)C1CCC2(CC1)CC(=O)C(c1c(C)cc(-c3ccc(F)cn3)cc1C)C(=O)C2 |
| InChI | InChI=1S/C26H29FN2O3/c1-15-10-18(20-5-4-19(27)14-29-20)11-16(2)23(15)24-21(30)12-26(13-22(24)31)8-6-17(7-9-26)25(32)28-3/h4-5,10-11,14,17,24H,6-9,12-13H2,1-3H3,(H,28,32) |
| InChIKey | OUHPHFPCIQBUDH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|