C27H30FNO3 — CID 155592177
3-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide (PubChem CID 155592177) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide.
| Compound Name | 3-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 155592177 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-N-methyl-2,4-dioxospiro[5.5]undecane-9-carboxamide |
| SMILES | CNC(=O)C1CCC2(CC1)CC(=O)C(c1c(C)cc(-c3ccc(F)cc3)cc1C)C(=O)C2 |
| InChI | InChI=1S/C27H30FNO3/c1-16-12-20(18-4-6-21(28)7-5-18)13-17(2)24(16)25-22(30)14-27(15-23(25)31)10-8-19(9-11-27)26(32)29-3/h4-7,12-13,19,25H,8-11,14-15H2,1-3H3,(H,29,32) |
| InChIKey | XMKCJBIWJKLLGS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|