C21H23NO5 — CID 15559220
6,7-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4,6,8,14,16(20)-hexaen-2-one (PubChem CID 15559220) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6,7-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4,6,8,14,16(20)-hexaen-2-one.
| Compound Name | 6,7-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4,6,8,14,16(20)-hexaen-2-one |
|---|---|
| PubChem CID | 15559220 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 6,7-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4,6,8,14,16(20)-hexaen-2-one |
| SMILES | COc1cc2c(cc1OC)CN(C)CCc1cc3c(cc1C(=O)C2)OCO3 |
| InChI | InChI=1S/C21H23NO5/c1-22-5-4-13-7-20-21(27-12-26-20)10-16(13)17(23)6-14-8-18(24-2)19(25-3)9-15(14)11-22/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | AGSOWAZSCZVVDU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |