C29H44FN3O4SSi — CID 155592295
methyl 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate (PubChem CID 155592295) has the molecular formula C29H44FN3O4SSi and a molecular weight of 577.84 g/mol. Its IUPAC name is methyl 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155592295 |
| Molecular Formula | C29H44FN3O4SSi |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | methyl 2-[4-[tert-butyl(dimethyl)silyl]oxybutylamino]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NCCCCO[Si](C)(C)C(C)(C)C)sc1CCCOc1ccc(C#CCN(C)C)cc1F |
| InChI | InChI=1S/C29H44FN3O4SSi/c1-29(2,3)39(7,8)37-20-10-9-17-31-28-32-26(27(34)35-6)25(38-28)14-12-19-36-24-16-15-22(21-23(24)30)13-11-18-33(4)5/h15-16,21H,9-10,12,14,17-20H2,1-8H3,(H,31,32) |
| InChIKey | JJZZFKFZLQZQMW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|