About methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate
methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate (PubChem CID 155592486) has the molecular formula C19H17N5O2S2
and a molecular weight of 411.51 g/mol. Its IUPAC name is methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate |
| PubChem CID | 155592486 |
| Molecular Formula | C19H17N5O2S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(N(C)c2cc(C)c(Nc3nc4ccccc4s3)nn2)s1 |
| InChI | InChI=1S/C19H17N5O2S2/c1-11-10-15(24(2)16-9-8-14(27-16)18(25)26-3)22-23-17(11)21-19-20-12-6-4-5-7-13(12)28-19/h4-10H,1-3H3,(H,20,21,23) |
| InChIKey | HGWUTZOGJSHIAZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate (CID 155592486) is methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate is COC(=O)c1ccc(N(C)c2cc(C)c(Nc3nc4ccccc4s3)nn2)s1.
What is the InChIKey of methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate?
The InChIKey is HGWUTZOGJSHIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2S2/c1-11-10-15(24(2)16-9-8-14(27-16)18(25)26-3)22-23-17(11)21-19-20-12-6-4-5-7-13(12)28-19/h4-10H,1-3H3,(H,20,21,23).
What are the key properties of methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate?
methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate has a molecular weight of 411.51 g/mol, XLogP of 4.75, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylate is sourced from PubChem (CID 155592486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).