About methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate
methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate (PubChem CID 155592694) has the molecular formula C19H16N6O2S
and a molecular weight of 392.44 g/mol. Its IUPAC name is methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate |
| PubChem CID | 155592694 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(N(C)c2ccc(Nc3nc4ccccc4s3)nn2)n1 |
| InChI | InChI=1S/C19H16N6O2S/c1-25(16-9-5-7-13(20-16)18(26)27-2)17-11-10-15(23-24-17)22-19-21-12-6-3-4-8-14(12)28-19/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | LYSCJDJHMQJOCW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate (CID 155592694) is methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate is COC(=O)c1cccc(N(C)c2ccc(Nc3nc4ccccc4s3)nn2)n1.
What is the InChIKey of methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate?
The InChIKey is LYSCJDJHMQJOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N6O2S/c1-25(16-9-5-7-13(20-16)18(26)27-2)17-11-10-15(23-24-17)22-19-21-12-6-3-4-8-14(12)28-19/h3-11H,1-2H3,(H,21,22,23).
What are the key properties of methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate?
methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate has a molecular weight of 392.44 g/mol, XLogP of 3.78, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[6-(1,3-benzothiazol-2-ylamino)pyridazin-3-yl]-methylamino]pyridine-2-carboxylate is sourced from PubChem (CID 155592694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).