About 4H-pyrrolo[1,2-a]indole
4H-pyrrolo[1,2-a]indole (PubChem CID 15559290) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 4H-pyrrolo[1,2-a]indole |
| PubChem CID | 15559290 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4H-pyrrolo[1,2-a]indole |
| SMILES | c1ccc2c(c1)Cc1cccn1-2 |
| InChI | InChI=1S/C11H9N/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)11/h1-7H,8H2 |
| InChIKey | JGCYQWJGSSQVSZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[1,2-a]indole?
The IUPAC name of 4H-pyrrolo[1,2-a]indole (CID 15559290) is 4H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 4H-pyrrolo[1,2-a]indole?
The canonical SMILES for 4H-pyrrolo[1,2-a]indole is c1ccc2c(c1)Cc1cccn1-2.
What is the InChIKey of 4H-pyrrolo[1,2-a]indole?
The InChIKey is JGCYQWJGSSQVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)11/h1-7H,8H2.
What are the key properties of 4H-pyrrolo[1,2-a]indole?
4H-pyrrolo[1,2-a]indole has a molecular weight of 155.20 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 15559290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).