About 6,12-dihydroindeno[1,2-b]fluorene
6,12-dihydroindeno[1,2-b]fluorene (PubChem CID 15559295) has the molecular formula C20H14
and a molecular weight of 254.33 g/mol. Its IUPAC name is 6,12-dihydroindeno[1,2-b]fluorene.
Molecular Properties
| Compound Name | 6,12-dihydroindeno[1,2-b]fluorene |
| PubChem CID | 15559295 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 6,12-dihydroindeno[1,2-b]fluorene |
| SMILES | c1ccc2c(c1)Cc1cc3c(cc1-2)Cc1ccccc1-3 |
| InChI | InChI=1S/C20H14/c1-3-7-17-13(5-1)9-15-11-20-16(12-19(15)17)10-14-6-2-4-8-18(14)20/h1-8,11-12H,9-10H2 |
| InChIKey | QBBPWJMJLXOORS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6,12-dihydroindeno[1,2-b]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,12-dihydroindeno[1,2-b]fluorene?
The IUPAC name of 6,12-dihydroindeno[1,2-b]fluorene (CID 15559295) is 6,12-dihydroindeno[1,2-b]fluorene.
What is the SMILES notation for 6,12-dihydroindeno[1,2-b]fluorene?
The canonical SMILES for 6,12-dihydroindeno[1,2-b]fluorene is c1ccc2c(c1)Cc1cc3c(cc1-2)Cc1ccccc1-3.
What is the InChIKey of 6,12-dihydroindeno[1,2-b]fluorene?
The InChIKey is QBBPWJMJLXOORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14/c1-3-7-17-13(5-1)9-15-11-20-16(12-19(15)17)10-14-6-2-4-8-18(14)20/h1-8,11-12H,9-10H2.
What are the key properties of 6,12-dihydroindeno[1,2-b]fluorene?
6,12-dihydroindeno[1,2-b]fluorene has a molecular weight of 254.33 g/mol, XLogP of 4.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,12-dihydroindeno[1,2-b]fluorene is sourced from PubChem (CID 15559295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).