About 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid
5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid (PubChem CID 155593117) has the molecular formula C18H15N5O2S2
and a molecular weight of 397.49 g/mol. Its IUPAC name is 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid |
| PubChem CID | 155593117 |
| Molecular Formula | C18H15N5O2S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(N(C)c2ccc(C(=O)O)s2)nnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H15N5O2S2/c1-10-9-14(23(2)15-8-7-13(26-15)17(24)25)21-22-16(10)20-18-19-11-5-3-4-6-12(11)27-18/h3-9H,1-2H3,(H,24,25)(H,19,20,22) |
| InChIKey | RZDZNMWMASTJOM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid?
The IUPAC name of 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid (CID 155593117) is 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid is Cc1cc(N(C)c2ccc(C(=O)O)s2)nnc1Nc1nc2ccccc2s1.
What is the InChIKey of 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid?
The InChIKey is RZDZNMWMASTJOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2S2/c1-10-9-14(23(2)15-8-7-13(26-15)17(24)25)21-22-16(10)20-18-19-11-5-3-4-6-12(11)27-18/h3-9H,1-2H3,(H,24,25)(H,19,20,22).
What are the key properties of 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid?
5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid has a molecular weight of 397.49 g/mol, XLogP of 4.67, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-methylamino]thiophene-2-carboxylic acid is sourced from PubChem (CID 155593117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).