C32H30FN7O3S2 — CID 155593509
2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6-dihydropyrrolo[2,3-c]pyridazin-7-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 155593509) has the molecular formula C32H30FN7O3S2 and a molecular weight of 643.77 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6-dihydropyrrolo[2,3-c]pyridazin-7-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6-dihydropyrrolo[2,3-c]pyridazin-7-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155593509 |
| Molecular Formula | C32H30FN7O3S2 |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6-dihydropyrrolo[2,3-c]pyridazin-7-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1c(Nc2nc3ccccc3s2)nnc2c1CCN2c1nc(C(=O)O)c(CCCOc2ccc(C#CCN(C)C)cc2F)s1 |
| InChI | InChI=1S/C32H30FN7O3S2/c1-19-21-14-16-40(29(21)38-37-28(19)36-31-34-23-9-4-5-10-25(23)44-31)32-35-27(30(41)42)26(45-32)11-7-17-43-24-13-12-20(18-22(24)33)8-6-15-39(2)3/h4-5,9-10,12-13,18H,7,11,14-17H2,1-3H3,(H,41,42)(H,34,36,37) |
| InChIKey | CFVRHJVXZNNSOC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|