C34H34FN7O3S2 — CID 155593687
2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-9-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 155593687) has the molecular formula C34H34FN7O3S2 and a molecular weight of 671.82 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-9-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-9-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155593687 |
| Molecular Formula | C34H34FN7O3S2 |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-9-yl]-5-[3-[4-[3-(dimethylamino)prop-1-ynyl]-2-fluorophenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1c(Nc2nc3ccccc3s2)nnc2c1CCCCN2c1nc(C(=O)O)c(CCCOc2ccc(C#CCN(C)C)cc2F)s1 |
| InChI | InChI=1S/C34H34FN7O3S2/c1-21-23-11-6-7-18-42(31(23)40-39-30(21)38-33-36-25-12-4-5-13-27(25)46-33)34-37-29(32(43)44)28(47-34)14-9-19-45-26-16-15-22(20-24(26)35)10-8-17-41(2)3/h4-5,12-13,15-16,20H,6-7,9,11,14,17-19H2,1-3H3,(H,43,44)(H,36,38,39) |
| InChIKey | XBPIXWLQWSFFKR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|