C33H32ClN7O3S2 — CID 155593766
2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[3-[2-chloro-4-[3-(dimethylamino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 155593766) has the molecular formula C33H32ClN7O3S2 and a molecular weight of 674.25 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[3-[2-chloro-4-[3-(dimethylamino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[3-[2-chloro-4-[3-(dimethylamino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155593766 |
| Molecular Formula | C33H32ClN7O3S2 |
| Molecular Weight | 674.25 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[3-[2-chloro-4-[3-(dimethylamino)prop-1-ynyl]phenoxy]propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1c(Nc2nc3ccccc3s2)nnc2c1CCCN2c1nc(C(=O)O)c(CCCOc2ccc(C#CCN(C)C)cc2Cl)s1 |
| InChI | InChI=1S/C33H32ClN7O3S2/c1-20-22-10-7-17-41(30(22)39-38-29(20)37-32-35-24-11-4-5-12-26(24)45-32)33-36-28(31(42)43)27(46-33)13-8-18-44-25-15-14-21(19-23(25)34)9-6-16-40(2)3/h4-5,11-12,14-15,19H,7-8,10,13,16-18H2,1-3H3,(H,42,43)(H,35,37,38) |
| InChIKey | NHBMFNWKPXJMPK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.25 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|