C14H13N5O2 — CID 155594022
3-[3-(4-ethylanilino)pyrazin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 155594022) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-[3-(4-ethylanilino)pyrazin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[3-(4-ethylanilino)pyrazin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 155594022 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[3-(4-ethylanilino)pyrazin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCc1ccc(Nc2nccnc2-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H13N5O2/c1-2-9-3-5-10(6-4-9)17-12-11(15-7-8-16-12)13-18-14(20)21-19-13/h3-8H,2H2,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | CKLODEWSMAODRZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |