About (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile
(2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile (PubChem CID 155594480) has the molecular formula C11H8Cl2N2S2
and a molecular weight of 303.24 g/mol. Its IUPAC name is (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile |
| PubChem CID | 155594480 |
| Molecular Formula | C11H8Cl2N2S2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile |
| SMILES | N#C/C(N)=C1/SCC(c2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C11H8Cl2N2S2/c12-6-1-2-7(8(13)3-6)10-5-16-11(17-10)9(15)4-14/h1-3,10H,5,15H2/b11-9+ |
| InChIKey | QOBOURWQPLJBLY-PKNBQFBNSA-N |
| XLogP | 4.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile?
The IUPAC name of (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile (CID 155594480) is (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile.
What is the SMILES notation for (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile?
The canonical SMILES for (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile is N#C/C(N)=C1/SCC(c2ccc(Cl)cc2Cl)S1.
What is the InChIKey of (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile?
The InChIKey is QOBOURWQPLJBLY-PKNBQFBNSA-N. The full InChI is InChI=1S/C11H8Cl2N2S2/c12-6-1-2-7(8(13)3-6)10-5-16-11(17-10)9(15)4-14/h1-3,10H,5,15H2/b11-9+.
What are the key properties of (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile?
(2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile has a molecular weight of 303.24 g/mol, XLogP of 4.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-amino-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]acetonitrile is sourced from PubChem (CID 155594480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).