About (3R)-3-(5-methylhex-5-enyl)dithiolane;propane
(3R)-3-(5-methylhex-5-enyl)dithiolane;propane (PubChem CID 155594485) has the molecular formula C13H26S2
and a molecular weight of 246.48 g/mol. Its IUPAC name is (3R)-3-(5-methylhex-5-enyl)dithiolane;propane.
Molecular Properties
| Compound Name | (3R)-3-(5-methylhex-5-enyl)dithiolane;propane |
| PubChem CID | 155594485 |
| Molecular Formula | C13H26S2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3R)-3-(5-methylhex-5-enyl)dithiolane;propane |
| SMILES | C=C(C)CCCC[C@@H]1CCSS1.CCC |
| InChI | InChI=1S/C10H18S2.C3H8/c1-9(2)5-3-4-6-10-7-8-11-12-10;1-3-2/h10H,1,3-8H2,2H3;3H2,1-2H3/t10-;/m1./s1 |
| InChIKey | DIZWSFVQGHFLAR-HNCPQSOCSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(5-methylhex-5-enyl)dithiolane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(5-methylhex-5-enyl)dithiolane;propane?
The IUPAC name of (3R)-3-(5-methylhex-5-enyl)dithiolane;propane (CID 155594485) is (3R)-3-(5-methylhex-5-enyl)dithiolane;propane.
What is the SMILES notation for (3R)-3-(5-methylhex-5-enyl)dithiolane;propane?
The canonical SMILES for (3R)-3-(5-methylhex-5-enyl)dithiolane;propane is C=C(C)CCCC[C@@H]1CCSS1.CCC.
What is the InChIKey of (3R)-3-(5-methylhex-5-enyl)dithiolane;propane?
The InChIKey is DIZWSFVQGHFLAR-HNCPQSOCSA-N. The full InChI is InChI=1S/C10H18S2.C3H8/c1-9(2)5-3-4-6-10-7-8-11-12-10;1-3-2/h10H,1,3-8H2,2H3;3H2,1-2H3/t10-;/m1./s1.
What are the key properties of (3R)-3-(5-methylhex-5-enyl)dithiolane;propane?
(3R)-3-(5-methylhex-5-enyl)dithiolane;propane has a molecular weight of 246.48 g/mol, XLogP of 5.69, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(5-methylhex-5-enyl)dithiolane;propane is sourced from PubChem (CID 155594485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).