C11H14ClF3N4 — CID 155594609
6-chloro-N-(piperidin-4-ylmethyl)-3-(trifluoromethyl)pyridazin-4-amine (PubChem CID 155594609) has the molecular formula C11H14ClF3N4 and a molecular weight of 294.71 g/mol. Its IUPAC name is 6-chloro-N-(piperidin-4-ylmethyl)-3-(trifluoromethyl)pyridazin-4-amine.
| Compound Name | 6-chloro-N-(piperidin-4-ylmethyl)-3-(trifluoromethyl)pyridazin-4-amine |
|---|---|
| PubChem CID | 155594609 |
| Molecular Formula | C11H14ClF3N4 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-chloro-N-(piperidin-4-ylmethyl)-3-(trifluoromethyl)pyridazin-4-amine |
| SMILES | FC(F)(F)c1nnc(Cl)cc1NCC1CCNCC1 |
| InChI | InChI=1S/C11H14ClF3N4/c12-9-5-8(10(19-18-9)11(13,14)15)17-6-7-1-3-16-4-2-7/h5,7,16H,1-4,6H2,(H,17,18) |
| InChIKey | ZMIHMCMXUQQMGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |