C50H34N4 — CID 155595102
2,4-bis(4-phenylphenyl)-6-[3-(2-phenylphenyl)-5-pyridin-4-ylphenyl]-1,3,5-triazine (PubChem CID 155595102) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 2,4-bis(4-phenylphenyl)-6-[3-(2-phenylphenyl)-5-pyridin-4-ylphenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-phenylphenyl)-6-[3-(2-phenylphenyl)-5-pyridin-4-ylphenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 155595102 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 2,4-bis(4-phenylphenyl)-6-[3-(2-phenylphenyl)-5-pyridin-4-ylphenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccncc5)cc(-c5ccccc5-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C50H34N4/c1-4-12-35(13-5-1)37-20-24-41(25-21-37)48-52-49(42-26-22-38(23-27-42)36-14-6-2-7-15-36)54-50(53-48)45-33-43(39-28-30-51-31-29-39)32-44(34-45)47-19-11-10-18-46(47)40-16-8-3-9-17-40/h1-34H |
| InChIKey | HKJBUQDLSAAIRG-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |