C9H9F4NO — CID 155595120
2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol (PubChem CID 155595120) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol.
| Compound Name | 2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol |
|---|---|
| PubChem CID | 155595120 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-(4-aminophenyl)-1,1,3,3-tetrafluoropropan-2-ol |
| SMILES | Nc1ccc(C(O)(C(F)F)C(F)F)cc1 |
| InChI | InChI=1S/C9H9F4NO/c10-7(11)9(15,8(12)13)5-1-3-6(14)4-2-5/h1-4,7-8,15H,14H2 |
| InChIKey | HNXSUOOXGYTUBB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|