C11H14F3N3O3 — CID 155595167
ethyl 3-oxo-3-[[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]propanoate (PubChem CID 155595167) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is ethyl 3-oxo-3-[[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]propanoate.
| Compound Name | ethyl 3-oxo-3-[[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 155595167 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | ethyl 3-oxo-3-[[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]propanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccnn1CCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3/c1-2-20-10(19)7-9(18)16-8-3-5-15-17(8)6-4-11(12,13)14/h3,5H,2,4,6-7H2,1H3,(H,16,18) |
| InChIKey | PQJCQECESZWEMH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|