About 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol
2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol (PubChem CID 155595299) has the molecular formula C11H12BrF3O2
and a molecular weight of 313.11 g/mol. Its IUPAC name is 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol |
| PubChem CID | 155595299 |
| Molecular Formula | C11H12BrF3O2 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(Br)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12BrF3O2/c1-10(2,16)7-3-4-8(12)9(5-7)17-6-11(13,14)15/h3-5,16H,6H2,1-2H3 |
| InChIKey | PJBMVXPUAPSRKD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol?
The IUPAC name of 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol (CID 155595299) is 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol.
What is the SMILES notation for 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol?
The canonical SMILES for 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol is CC(C)(O)c1ccc(Br)c(OCC(F)(F)F)c1.
What is the InChIKey of 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol?
The InChIKey is PJBMVXPUAPSRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrF3O2/c1-10(2,16)7-3-4-8(12)9(5-7)17-6-11(13,14)15/h3-5,16H,6H2,1-2H3.
What are the key properties of 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol?
2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol has a molecular weight of 313.11 g/mol, XLogP of 3.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]propan-2-ol is sourced from PubChem (CID 155595299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).